C20H23FN6 — CID 111230685
1-ethyl-3-[2-(4-fluorophenyl)ethyl]-2-[(2-imidazol-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 111230685) has the molecular formula C20H23FN6 and a molecular weight of 366.44 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-fluorophenyl)ethyl]-2-[(2-imidazol-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(4-fluorophenyl)ethyl]-2-[(2-imidazol-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111230685 |
| Molecular Formula | C20H23FN6 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 1-ethyl-3-[2-(4-fluorophenyl)ethyl]-2-[(2-imidazol-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(-n2ccnc2)c1)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FN6/c1-2-23-20(25-10-7-16-3-5-18(21)6-4-16)26-14-17-8-9-24-19(13-17)27-12-11-22-15-27/h3-6,8-9,11-13,15H,2,7,10,14H2,1H3,(H2,23,25,26) |
| InChIKey | ITDFHTSGSHTQEE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|