C17H26N6 — CID 110977717
1-ethyl-2-[(2-imidazol-1-yl-4-pyridinyl)methyl]-3-(3-methylbutyl)guanidine (PubChem CID 110977717) has the molecular formula C17H26N6 and a molecular weight of 314.44 g/mol. Its IUPAC name is 1-ethyl-2-[(2-imidazol-1-yl-4-pyridinyl)methyl]-3-(3-methylbutyl)guanidine.
| Compound Name | 1-ethyl-2-[(2-imidazol-1-yl-4-pyridinyl)methyl]-3-(3-methylbutyl)guanidine |
|---|---|
| PubChem CID | 110977717 |
| Molecular Formula | C17H26N6 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 1-ethyl-2-[(2-imidazol-1-yl-4-pyridinyl)methyl]-3-(3-methylbutyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(-n2ccnc2)c1)NCCC(C)C |
| InChI | InChI=1S/C17H26N6/c1-4-19-17(21-7-5-14(2)3)22-12-15-6-8-20-16(11-15)23-10-9-18-13-23/h6,8-11,13-14H,4-5,7,12H2,1-3H3,(H2,19,21,22) |
| InChIKey | GLKOYDBEXBCOOJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|