C19H22FIN6 — CID 111266846
1-ethyl-3-[(2-fluorophenyl)methyl]-2-[(2-imidazol-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111266846) has the molecular formula C19H22FIN6 and a molecular weight of 480.33 g/mol. Its IUPAC name is 1-ethyl-3-[(2-fluorophenyl)methyl]-2-[(2-imidazol-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(2-fluorophenyl)methyl]-2-[(2-imidazol-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111266846 |
| Molecular Formula | C19H22FIN6 |
| Molecular Weight | 480.33 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 1-ethyl-3-[(2-fluorophenyl)methyl]-2-[(2-imidazol-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(-n2ccnc2)c1)NCc1ccccc1F.I |
| InChI | InChI=1S/C19H21FN6.HI/c1-2-22-19(25-13-16-5-3-4-6-17(16)20)24-12-15-7-8-23-18(11-15)26-10-9-21-14-26;/h3-11,14H,2,12-13H2,1H3,(H2,22,24,25);1H |
| InChIKey | MCLGZIBNJFBRKU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|