C20H22F3IN6 — CID 111268424
1-ethyl-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111268424) has the molecular formula C20H22F3IN6 and a molecular weight of 530.34 g/mol. Its IUPAC name is 1-ethyl-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111268424 |
| Molecular Formula | C20H22F3IN6 |
| Molecular Weight | 530.34 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | 1-ethyl-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(F)(F)F)c1)NCc1ccnc(-n2ccnc2)c1.I |
| InChI | InChI=1S/C20H21F3N6.HI/c1-2-25-19(27-12-15-4-3-5-17(10-15)20(21,22)23)28-13-16-6-7-26-18(11-16)29-9-8-24-14-29;/h3-11,14H,2,12-13H2,1H3,(H2,25,27,28);1H |
| InChIKey | GFRKCDLAJYMJJX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|