C17H20N6S — CID 111939867
1-ethyl-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-(thiophen-3-ylmethyl)guanidine (PubChem CID 111939867) has the molecular formula C17H20N6S and a molecular weight of 340.46 g/mol. Its IUPAC name is 1-ethyl-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111939867 |
| Molecular Formula | C17H20N6S |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-ethyl-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-(thiophen-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccsc1)NCc1ccnc(-n2ccnc2)c1 |
| InChI | InChI=1S/C17H20N6S/c1-2-19-17(22-11-15-4-8-24-12-15)21-10-14-3-5-20-16(9-14)23-7-6-18-13-23/h3-9,12-13H,2,10-11H2,1H3,(H2,19,21,22) |
| InChIKey | CNDYIRKIHIHTDV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|