C22H29IN6 — CID 111621985
1-ethyl-2-[(2-imidazol-1-yl-4-pyridinyl)methyl]-3-[2-(4-methylphenyl)propyl]guanidine;hydroiodide (PubChem CID 111621985) has the molecular formula C22H29IN6 and a molecular weight of 504.42 g/mol. Its IUPAC name is 1-ethyl-2-[(2-imidazol-1-yl-4-pyridinyl)methyl]-3-[2-(4-methylphenyl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-imidazol-1-yl-4-pyridinyl)methyl]-3-[2-(4-methylphenyl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111621985 |
| Molecular Formula | C22H29IN6 |
| Molecular Weight | 504.42 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 1-ethyl-2-[(2-imidazol-1-yl-4-pyridinyl)methyl]-3-[2-(4-methylphenyl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(-n2ccnc2)c1)NCC(C)c1ccc(C)cc1.I |
| InChI | InChI=1S/C22H28N6.HI/c1-4-24-22(26-14-18(3)20-7-5-17(2)6-8-20)27-15-19-9-10-25-21(13-19)28-12-11-23-16-28;/h5-13,16,18H,4,14-15H2,1-3H3,(H2,24,26,27);1H |
| InChIKey | XSSHMOUNUKJZHZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|