C19H21FN6 — CID 111229723
1-[2-(4-fluorophenyl)ethyl]-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-methylguanidine (PubChem CID 111229723) has the molecular formula C19H21FN6 and a molecular weight of 352.42 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111229723 |
| Molecular Formula | C19H21FN6 |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1ccc(F)cc1)NCc1ccnc(-n2ccnc2)c1 |
| InChI | InChI=1S/C19H21FN6/c1-21-19(24-9-6-15-2-4-17(20)5-3-15)25-13-16-7-8-23-18(12-16)26-11-10-22-14-26/h2-5,7-8,10-12,14H,6,9,13H2,1H3,(H2,21,24,25) |
| InChIKey | IHXTVXPRMWISOJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|