C26H28N6 — CID 111233727
1-(3,3-diphenylpropyl)-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-methylguanidine (PubChem CID 111233727) has the molecular formula C26H28N6 and a molecular weight of 424.55 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-methylguanidine.
| Compound Name | 1-(3,3-diphenylpropyl)-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111233727 |
| Molecular Formula | C26H28N6 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-3-[(2-imidazol-1-yl-4-pyridinyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCC(c1ccccc1)c1ccccc1)NCc1ccnc(-n2ccnc2)c1 |
| InChI | InChI=1S/C26H28N6/c1-27-26(31-19-21-12-14-29-25(18-21)32-17-16-28-20-32)30-15-13-24(22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-12,14,16-18,20,24H,13,15,19H2,1H3,(H2,27,30,31) |
| InChIKey | VXURIJHMCKNCIU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|