C23H27FN6 — CID 111911554
4-(4-fluorophenyl)-N'-[[1-(2-phenylethyl)imidazol-2-yl]methyl]piperazine-1-carboximidamide (PubChem CID 111911554) has the molecular formula C23H27FN6 and a molecular weight of 406.51 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[[1-(2-phenylethyl)imidazol-2-yl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[[1-(2-phenylethyl)imidazol-2-yl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111911554 |
| Molecular Formula | C23H27FN6 |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[[1-(2-phenylethyl)imidazol-2-yl]methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1nccn1CCc1ccccc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H27FN6/c24-20-6-8-21(9-7-20)28-14-16-30(17-15-28)23(25)27-18-22-26-11-13-29(22)12-10-19-4-2-1-3-5-19/h1-9,11,13H,10,12,14-18H2,(H2,25,27) |
| InChIKey | PLNHOPWHHYCLDS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|