C21H24FIN6 — CID 111074504
4-(4-fluorophenyl)-N'-[(2-pyrazol-1-ylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111074504) has the molecular formula C21H24FIN6 and a molecular weight of 506.37 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[(2-pyrazol-1-ylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-fluorophenyl)-N'-[(2-pyrazol-1-ylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111074504 |
| Molecular Formula | C21H24FIN6 |
| Molecular Weight | 506.37 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[(2-pyrazol-1-ylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccccc1-n1cccn1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H23FN6.HI/c22-18-6-8-19(9-7-18)26-12-14-27(15-13-26)21(23)24-16-17-4-1-2-5-20(17)28-11-3-10-25-28;/h1-11H,12-16H2,(H2,23,24);1H |
| InChIKey | NBRWOEUZPXFHEO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 62.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|