C22H31FIN5O2S — CID 111082266
N'-[[2-(tert-butylsulfamoyl)phenyl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111082266) has the molecular formula C22H31FIN5O2S and a molecular weight of 575.49 g/mol. Its IUPAC name is N'-[[2-(tert-butylsulfamoyl)phenyl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[2-(tert-butylsulfamoyl)phenyl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111082266 |
| Molecular Formula | C22H31FIN5O2S |
| Molecular Weight | 575.49 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | N'-[[2-(tert-butylsulfamoyl)phenyl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccccc1C/N=C(\N)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C22H30FN5O2S.HI/c1-22(2,3)26-31(29,30)20-7-5-4-6-17(20)16-25-21(24)28-14-12-27(13-15-28)19-10-8-18(23)9-11-19;/h4-11,26H,12-16H2,1-3H3,(H2,24,25);1H |
| InChIKey | SAWSBUDFPMAAGO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|