C16H27FIN5O2S — CID 111093532
N'-[3-(ethylsulfonylamino)propyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111093532) has the molecular formula C16H27FIN5O2S and a molecular weight of 499.39 g/mol. Its IUPAC name is N'-[3-(ethylsulfonylamino)propyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[3-(ethylsulfonylamino)propyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111093532 |
| Molecular Formula | C16H27FIN5O2S |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | N'-[3-(ethylsulfonylamino)propyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCS(=O)(=O)NCCC/N=C(\N)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C16H26FN5O2S.HI/c1-2-25(23,24)20-9-3-8-19-16(18)22-12-10-21(11-13-22)15-6-4-14(17)5-7-15;/h4-7,20H,2-3,8-13H2,1H3,(H2,18,19);1H |
| InChIKey | QZXZITVQHKGQCN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|