C17H29FIN5O2S — CID 111165006
N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111165006) has the molecular formula C17H29FIN5O2S and a molecular weight of 513.42 g/mol. Its IUPAC name is N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111165006 |
| Molecular Formula | C17H29FIN5O2S |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | N-ethyl-N'-[2-(ethylsulfonylamino)ethyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)CC)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C17H28FN5O2S.HI/c1-3-19-17(20-9-10-21-26(24,25)4-2)23-13-11-22(12-14-23)16-7-5-15(18)6-8-16;/h5-8,21H,3-4,9-14H2,1-2H3,(H,19,20);1H |
| InChIKey | UWLFYLBACNIRHH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|