C19H31FIN5O2S — CID 111165408
N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethyl-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111165408) has the molecular formula C19H31FIN5O2S and a molecular weight of 539.46 g/mol. Its IUPAC name is N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethyl-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethyl-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111165408 |
| Molecular Formula | C19H31FIN5O2S |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethyl-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCS(=O)(=O)CC1)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C19H30FN5O2S.HI/c1-2-21-19(22-7-8-23-13-15-28(26,27)16-14-23)25-11-9-24(10-12-25)18-5-3-17(20)4-6-18;/h3-6H,2,7-16H2,1H3,(H,21,22);1H |
| InChIKey | MSSMHPXWUXHSEN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|