C22H35N5O2S — CID 111218889
N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethyl-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carboximidamide (PubChem CID 111218889) has the molecular formula C22H35N5O2S and a molecular weight of 433.62 g/mol. Its IUPAC name is N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethyl-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carboximidamide.
| Compound Name | N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethyl-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111218889 |
| Molecular Formula | C22H35N5O2S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethyl-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCN1CCS(=O)(=O)CC1)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C22H35N5O2S/c1-2-23-22(24-10-12-26-17-19-30(28,29)20-18-26)27-15-13-25(14-16-27)11-6-9-21-7-4-3-5-8-21/h3-9H,2,10-20H2,1H3,(H,23,24)/b9-6+ |
| InChIKey | JPMIOQNWHWKAKH-RMKNXTFCSA-N |
| XLogP | 1.01 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|