C20H31IN4O2 — CID 111218792
methyl 3-[[ethylamino-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]propanoate;hydroiodide (PubChem CID 111218792) has the molecular formula C20H31IN4O2 and a molecular weight of 486.40 g/mol. Its IUPAC name is methyl 3-[[ethylamino-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[[ethylamino-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111218792 |
| Molecular Formula | C20H31IN4O2 |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | methyl 3-[[ethylamino-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]propanoate;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)OC)N1CCN(C/C=C/c2ccccc2)CC1.I |
| InChI | InChI=1S/C20H30N4O2.HI/c1-3-21-20(22-12-11-19(25)26-2)24-16-14-23(15-17-24)13-7-10-18-8-5-4-6-9-18;/h4-10H,3,11-17H2,1-2H3,(H,21,22);1H/b10-7+; |
| InChIKey | QXACBXJSAWBTNH-HCUGZAAXSA-N |
| XLogP | 2.46 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|