C25H40N6O — CID 111218513
1-[3-[[ethylamino-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]propyl]piperidine-3-carboxamide (PubChem CID 111218513) has the molecular formula C25H40N6O and a molecular weight of 440.64 g/mol. Its IUPAC name is 1-[3-[[ethylamino-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]propyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[ethylamino-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111218513 |
| Molecular Formula | C25H40N6O |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | 1-[3-[[ethylamino-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]propyl]piperidine-3-carboxamide |
| SMILES | CCN/C(=N\CCCN1CCCC(C(N)=O)C1)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C25H40N6O/c1-2-27-25(28-13-8-16-30-15-7-12-23(21-30)24(26)32)31-19-17-29(18-20-31)14-6-11-22-9-4-3-5-10-22/h3-6,9-11,23H,2,7-8,12-21H2,1H3,(H2,26,32)(H,27,28)/b11-6+ |
| InChIKey | KDCPBVMQJDEYOD-IZZDOVSWSA-N |
| XLogP | 1.87 |
| TPSA | 77.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|