C23H35N5O — CID 111218425
N-cyclopropyl-4-[[ethylamino-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]butanamide (PubChem CID 111218425) has the molecular formula C23H35N5O and a molecular weight of 397.57 g/mol. Its IUPAC name is N-cyclopropyl-4-[[ethylamino-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]butanamide.
| Compound Name | N-cyclopropyl-4-[[ethylamino-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]butanamide |
|---|---|
| PubChem CID | 111218425 |
| Molecular Formula | C23H35N5O |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | N-cyclopropyl-4-[[ethylamino-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]butanamide |
| SMILES | CCN/C(=N\CCCC(=O)NC1CC1)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C23H35N5O/c1-2-24-23(25-14-6-11-22(29)26-21-12-13-21)28-18-16-27(17-19-28)15-7-10-20-8-4-3-5-9-20/h3-5,7-10,21H,2,6,11-19H2,1H3,(H,24,25)(H,26,29)/b10-7+ |
| InChIKey | CGKNXRQFLVFVEL-JXMROGBWSA-N |
| XLogP | 2.34 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|