C18H35N5O — CID 111326982
N-cyclopropyl-4-[[ethylamino-[4-(2-methylpropyl)piperazin-1-yl]methylidene]amino]butanamide (PubChem CID 111326982) has the molecular formula C18H35N5O and a molecular weight of 337.51 g/mol. Its IUPAC name is N-cyclopropyl-4-[[ethylamino-[4-(2-methylpropyl)piperazin-1-yl]methylidene]amino]butanamide.
| Compound Name | N-cyclopropyl-4-[[ethylamino-[4-(2-methylpropyl)piperazin-1-yl]methylidene]amino]butanamide |
|---|---|
| PubChem CID | 111326982 |
| Molecular Formula | C18H35N5O |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.28 |
| IUPAC Name | N-cyclopropyl-4-[[ethylamino-[4-(2-methylpropyl)piperazin-1-yl]methylidene]amino]butanamide |
| SMILES | CCN/C(=N\CCCC(=O)NC1CC1)N1CCN(CC(C)C)CC1 |
| InChI | InChI=1S/C18H35N5O/c1-4-19-18(20-9-5-6-17(24)21-16-7-8-16)23-12-10-22(11-13-23)14-15(2)3/h15-16H,4-14H2,1-3H3,(H,19,20)(H,21,24) |
| InChIKey | XIHJYUZFUAOWBA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|