C19H37IN6O3 — CID 111412071
N-cyclopropyl-4-[[ethylamino-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]methylidene]amino]butanamide;hydroiodide (PubChem CID 111412071) has the molecular formula C19H37IN6O3 and a molecular weight of 524.45 g/mol. Its IUPAC name is N-cyclopropyl-4-[[ethylamino-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]methylidene]amino]butanamide;hydroiodide.
| Compound Name | N-cyclopropyl-4-[[ethylamino-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]methylidene]amino]butanamide;hydroiodide |
|---|---|
| PubChem CID | 111412071 |
| Molecular Formula | C19H37IN6O3 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | N-cyclopropyl-4-[[ethylamino-[4-[2-(2-methoxyethylamino)-2-oxoethyl]piperazin-1-yl]methylidene]amino]butanamide;hydroiodide |
| SMILES | CCN/C(=N\CCCC(=O)NC1CC1)N1CCN(CC(=O)NCCOC)CC1.I |
| InChI | InChI=1S/C19H36N6O3.HI/c1-3-20-19(22-8-4-5-17(26)23-16-6-7-16)25-12-10-24(11-13-25)15-18(27)21-9-14-28-2;/h16H,3-15H2,1-2H3,(H,20,22)(H,21,27)(H,23,26);1H |
| InChIKey | HGGUCFKQBCLAJT-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|