C19H31N5O3 — CID 111412104
2-[4-[N-ethyl-N'-[(4-hydroxyphenyl)methyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 111412104) has the molecular formula C19H31N5O3 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[4-[N-ethyl-N'-[(4-hydroxyphenyl)methyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-[N-ethyl-N'-[(4-hydroxyphenyl)methyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 111412104 |
| Molecular Formula | C19H31N5O3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | 2-[4-[N-ethyl-N'-[(4-hydroxyphenyl)methyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | CCN/C(=N\Cc1ccc(O)cc1)N1CCN(CC(=O)NCCOC)CC1 |
| InChI | InChI=1S/C19H31N5O3/c1-3-20-19(22-14-16-4-6-17(25)7-5-16)24-11-9-23(10-12-24)15-18(26)21-8-13-27-2/h4-7,25H,3,8-15H2,1-2H3,(H,20,22)(H,21,26) |
| InChIKey | MLPBSJLRKFUESF-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|