C21H36IN5O4 — CID 111412169
2-[4-[N-ethyl-N'-[2-hydroxy-2-(4-methoxyphenyl)ethyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 111412169) has the molecular formula C21H36IN5O4 and a molecular weight of 549.45 g/mol. Its IUPAC name is 2-[4-[N-ethyl-N'-[2-hydroxy-2-(4-methoxyphenyl)ethyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[4-[N-ethyl-N'-[2-hydroxy-2-(4-methoxyphenyl)ethyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111412169 |
| Molecular Formula | C21H36IN5O4 |
| Molecular Weight | 549.45 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 2-[4-[N-ethyl-N'-[2-hydroxy-2-(4-methoxyphenyl)ethyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC)cc1)N1CCN(CC(=O)NCCOC)CC1.I |
| InChI | InChI=1S/C21H35N5O4.HI/c1-4-22-21(24-15-19(27)17-5-7-18(30-3)8-6-17)26-12-10-25(11-13-26)16-20(28)23-9-14-29-2;/h5-8,19,27H,4,9-16H2,1-3H3,(H,22,24)(H,23,28);1H |
| InChIKey | ZQZLLLRQNAOFCW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.45 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|