C22H37N5O4 — CID 111503653
2-[4-[N-ethyl-N'-[2-(2-methoxyphenoxy)propyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 111503653) has the molecular formula C22H37N5O4 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-[4-[N-ethyl-N'-[2-(2-methoxyphenoxy)propyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-[N-ethyl-N'-[2-(2-methoxyphenoxy)propyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 111503653 |
| Molecular Formula | C22H37N5O4 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | 2-[4-[N-ethyl-N'-[2-(2-methoxyphenoxy)propyl]carbamimidoyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | CCN/C(=N\CC(C)Oc1ccccc1OC)N1CCN(CC(=O)NCCOC)CC1 |
| InChI | InChI=1S/C22H37N5O4/c1-5-23-22(25-16-18(2)31-20-9-7-6-8-19(20)30-4)27-13-11-26(12-14-27)17-21(28)24-10-15-29-3/h6-9,18H,5,10-17H2,1-4H3,(H,23,25)(H,24,28) |
| InChIKey | KJAAZYZIHYATSX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|