C22H37N5O3 — CID 111991151
2-[4-[[N-ethyl-N'-[2-hydroxy-2-(4-methoxyphenyl)ethyl]carbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide (PubChem CID 111991151) has the molecular formula C22H37N5O3 and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-[4-[[N-ethyl-N'-[2-hydroxy-2-(4-methoxyphenyl)ethyl]carbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-[[N-ethyl-N'-[2-hydroxy-2-(4-methoxyphenyl)ethyl]carbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 111991151 |
| Molecular Formula | C22H37N5O3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | 2-[4-[[N-ethyl-N'-[2-hydroxy-2-(4-methoxyphenyl)ethyl]carbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1CCC(N/C(=N/CC(O)c2ccc(OC)cc2)NCC)CC1 |
| InChI | InChI=1S/C22H37N5O3/c1-4-12-24-21(29)16-27-13-10-18(11-14-27)26-22(23-5-2)25-15-20(28)17-6-8-19(30-3)9-7-17/h6-9,18,20,28H,4-5,10-16H2,1-3H3,(H,24,29)(H2,23,25,26) |
| InChIKey | DPSRPZRQJQTRED-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|