C16H26IN3O4S — CID 111141816
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111141816) has the molecular formula C16H26IN3O4S and a molecular weight of 483.37 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111141816 |
| Molecular Formula | C16H26IN3O4S |
| Molecular Weight | 483.37 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC)cc1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C16H25N3O4S.HI/c1-3-17-16(19-13-8-9-24(21,22)11-13)18-10-15(20)12-4-6-14(23-2)7-5-12;/h4-7,13,15,20H,3,8-11H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | CWQJDBJFYLRJBG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|