C17H27N3O4S — CID 111787951
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(4-methoxyphenoxy)propyl]guanidine (PubChem CID 111787951) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(4-methoxyphenoxy)propyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(4-methoxyphenoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111787951 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(4-methoxyphenoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)Oc1ccc(OC)cc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H27N3O4S/c1-4-18-17(20-14-9-10-25(21,22)12-14)19-11-13(2)24-16-7-5-15(23-3)6-8-16/h5-8,13-14H,4,9-12H2,1-3H3,(H2,18,19,20) |
| InChIKey | PUZMRIVGMAXPOG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|