C16H25ClIN3O3S — CID 111499216
2-[2-(2-chlorophenoxy)propyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide (PubChem CID 111499216) has the molecular formula C16H25ClIN3O3S and a molecular weight of 501.82 g/mol. Its IUPAC name is 2-[2-(2-chlorophenoxy)propyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[2-(2-chlorophenoxy)propyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111499216 |
| Molecular Formula | C16H25ClIN3O3S |
| Molecular Weight | 501.82 g/mol |
| Exact Mass | 501.03 |
| IUPAC Name | 2-[2-(2-chlorophenoxy)propyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)Oc1ccccc1Cl)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C16H24ClN3O3S.HI/c1-3-18-16(20-13-8-9-24(21,22)11-13)19-10-12(2)23-15-7-5-4-6-14(15)17;/h4-7,12-13H,3,8-11H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | IEKHAMKBRUFZML-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|