C24H33ClN4O2 — CID 111990103
1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]guanidine (PubChem CID 111990103) has the molecular formula C24H33ClN4O2 and a molecular weight of 445.01 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]guanidine.
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111990103 |
| Molecular Formula | C24H33ClN4O2 |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-ethyl-2-[2-hydroxy-2-(4-methoxyphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC)cc1)NC1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H33ClN4O2/c1-3-26-24(27-16-23(30)19-6-10-22(31-2)11-7-19)28-21-12-14-29(15-13-21)17-18-4-8-20(25)9-5-18/h4-11,21,23,30H,3,12-17H2,1-2H3,(H2,26,27,28) |
| InChIKey | QMUGTLXWEPSENM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|