C18H28ClF2IN4O — CID 111992870
2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-ethylguanidine;hydroiodide (PubChem CID 111992870) has the molecular formula C18H28ClF2IN4O and a molecular weight of 516.80 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111992870 |
| Molecular Formula | C18H28ClF2IN4O |
| Molecular Weight | 516.80 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)cc1)NC1CCN(CC(F)F)CC1.I |
| InChI | InChI=1S/C18H27ClF2N4O.HI/c1-2-22-18(23-11-16(26)13-3-5-14(19)6-4-13)24-15-7-9-25(10-8-15)12-17(20)21;/h3-6,15-17,26H,2,7-12H2,1H3,(H2,22,23,24);1H |
| InChIKey | STDQOJMOYMZIKG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.80 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|