C20H33ClF2IN5 — CID 111993380
2-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-ethylguanidine;hydroiodide (PubChem CID 111993380) has the molecular formula C20H33ClF2IN5 and a molecular weight of 543.87 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111993380 |
| Molecular Formula | C20H33ClF2IN5 |
| Molecular Weight | 543.87 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-(dimethylamino)ethyl]-1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccc(Cl)cc1)N(C)C)NC1CCN(CC(F)F)CC1.I |
| InChI | InChI=1S/C20H32ClF2N5.HI/c1-4-24-20(26-17-9-11-28(12-10-17)14-19(22)23)25-13-18(27(2)3)15-5-7-16(21)8-6-15;/h5-8,17-19H,4,9-14H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | BXRAKDGXXBCFHK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.87 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|