C19H30F4IN5 — CID 111915618
2-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111915618) has the molecular formula C19H30F4IN5 and a molecular weight of 531.38 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 2-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111915618 |
| Molecular Formula | C19H30F4IN5 |
| Molecular Weight | 531.38 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 2-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccc(F)cc1)N(C)C)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C19H29F4N5.HI/c1-4-24-18(26-16-9-10-28(12-16)13-19(21,22)23)25-11-17(27(2)3)14-5-7-15(20)8-6-14;/h5-8,16-17H,4,9-13H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | WLERBZWILYDEFA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|