C22H34F3N5O — CID 111915717
1-ethyl-2-[2-(4-methylphenyl)-2-morpholin-4-ylethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111915717) has the molecular formula C22H34F3N5O and a molecular weight of 441.54 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-methylphenyl)-2-morpholin-4-ylethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-ethyl-2-[2-(4-methylphenyl)-2-morpholin-4-ylethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111915717 |
| Molecular Formula | C22H34F3N5O |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 1-ethyl-2-[2-(4-methylphenyl)-2-morpholin-4-ylethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccc(C)cc1)N1CCOCC1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C22H34F3N5O/c1-3-26-21(28-19-8-9-29(15-19)16-22(23,24)25)27-14-20(30-10-12-31-13-11-30)18-6-4-17(2)5-7-18/h4-7,19-20H,3,8-16H2,1-2H3,(H2,26,27,28) |
| InChIKey | YHCAHKBHIOBZGB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|