C21H32F3N5 — CID 111326410
1-ethyl-2-(2-phenyl-2-pyrrolidin-1-ylethyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111326410) has the molecular formula C21H32F3N5 and a molecular weight of 411.52 g/mol. Its IUPAC name is 1-ethyl-2-(2-phenyl-2-pyrrolidin-1-ylethyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-ethyl-2-(2-phenyl-2-pyrrolidin-1-ylethyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111326410 |
| Molecular Formula | C21H32F3N5 |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 1-ethyl-2-(2-phenyl-2-pyrrolidin-1-ylethyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccccc1)N1CCCC1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C21H32F3N5/c1-2-25-20(27-18-10-13-28(15-18)16-21(22,23)24)26-14-19(29-11-6-7-12-29)17-8-4-3-5-9-17/h3-5,8-9,18-19H,2,6-7,10-16H2,1H3,(H2,25,26,27) |
| InChIKey | ODIDXTADRZHQTH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|