C18H28F3IN4O — CID 111994194
1-ethyl-2-(2-hydroxy-3-phenylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111994194) has the molecular formula C18H28F3IN4O and a molecular weight of 500.35 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-3-phenylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-hydroxy-3-phenylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111994194 |
| Molecular Formula | C18H28F3IN4O |
| Molecular Weight | 500.35 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-3-phenylpropyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)Cc1ccccc1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C18H27F3N4O.HI/c1-2-22-17(23-11-16(26)10-14-6-4-3-5-7-14)24-15-8-9-25(12-15)13-18(19,20)21;/h3-7,15-16,26H,2,8-13H2,1H3,(H2,22,23,24);1H |
| InChIKey | QLSAYYXZQXCCLD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|