C18H28F3IN4 — CID 111916239
1-ethyl-2-[2-(3-methylphenyl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111916239) has the molecular formula C18H28F3IN4 and a molecular weight of 484.35 g/mol. Its IUPAC name is 1-ethyl-2-[2-(3-methylphenyl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(3-methylphenyl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111916239 |
| Molecular Formula | C18H28F3IN4 |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 1-ethyl-2-[2-(3-methylphenyl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1cccc(C)c1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C18H27F3N4.HI/c1-3-22-17(23-9-7-15-6-4-5-14(2)11-15)24-16-8-10-25(12-16)13-18(19,20)21;/h4-6,11,16H,3,7-10,12-13H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | IKTIGVNRSJANHO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|