C20H28F3IN6 — CID 111863855
1-ethyl-2-[2-(4-pyrazol-1-ylphenyl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111863855) has the molecular formula C20H28F3IN6 and a molecular weight of 536.38 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-pyrazol-1-ylphenyl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(4-pyrazol-1-ylphenyl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111863855 |
| Molecular Formula | C20H28F3IN6 |
| Molecular Weight | 536.38 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 1-ethyl-2-[2-(4-pyrazol-1-ylphenyl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(-n2cccn2)cc1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C20H27F3N6.HI/c1-2-24-19(27-17-9-13-28(14-17)15-20(21,22)23)25-11-8-16-4-6-18(7-5-16)29-12-3-10-26-29;/h3-7,10,12,17H,2,8-9,11,13-15H2,1H3,(H2,24,25,27);1H |
| InChIKey | FEFRKBMTDWGLON-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|