C20H30IN5O — CID 111189959
1-ethyl-3-(4-hydroxycyclohexyl)-2-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111189959) has the molecular formula C20H30IN5O and a molecular weight of 483.40 g/mol. Its IUPAC name is 1-ethyl-3-(4-hydroxycyclohexyl)-2-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(4-hydroxycyclohexyl)-2-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111189959 |
| Molecular Formula | C20H30IN5O |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 1-ethyl-3-(4-hydroxycyclohexyl)-2-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(-n2cccn2)cc1)NC1CCC(O)CC1.I |
| InChI | InChI=1S/C20H29N5O.HI/c1-2-21-20(24-17-6-10-19(26)11-7-17)22-14-12-16-4-8-18(9-5-16)25-15-3-13-23-25;/h3-5,8-9,13,15,17,19,26H,2,6-7,10-12,14H2,1H3,(H2,21,22,24);1H |
| InChIKey | GUSGLVPRXQPVNJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|