C24H34IN3O — CID 111190741
2-(3,3-diphenylpropyl)-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide (PubChem CID 111190741) has the molecular formula C24H34IN3O and a molecular weight of 507.46 g/mol. Its IUPAC name is 2-(3,3-diphenylpropyl)-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide.
| Compound Name | 2-(3,3-diphenylpropyl)-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111190741 |
| Molecular Formula | C24H34IN3O |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 2-(3,3-diphenylpropyl)-1-ethyl-3-(4-hydroxycyclohexyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC(c1ccccc1)c1ccccc1)NC1CCC(O)CC1.I |
| InChI | InChI=1S/C24H33N3O.HI/c1-2-25-24(27-21-13-15-22(28)16-14-21)26-18-17-23(19-9-5-3-6-10-19)20-11-7-4-8-12-20;/h3-12,21-23,28H,2,13-18H2,1H3,(H2,25,26,27);1H |
| InChIKey | DUSQYZGNLDVEMR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|