C20H30F3N3O — CID 111978971
1-ethyl-3-(4-hydroxycyclohexyl)-2-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine (PubChem CID 111978971) has the molecular formula C20H30F3N3O and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-ethyl-3-(4-hydroxycyclohexyl)-2-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine.
| Compound Name | 1-ethyl-3-(4-hydroxycyclohexyl)-2-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine |
|---|---|
| PubChem CID | 111978971 |
| Molecular Formula | C20H30F3N3O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 1-ethyl-3-(4-hydroxycyclohexyl)-2-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine |
| SMILES | CCN/C(=N\CCC(C)c1cccc(C(F)(F)F)c1)NC1CCC(O)CC1 |
| InChI | InChI=1S/C20H30F3N3O/c1-3-24-19(26-17-7-9-18(27)10-8-17)25-12-11-14(2)15-5-4-6-16(13-15)20(21,22)23/h4-6,13-14,17-18,27H,3,7-12H2,1-2H3,(H2,24,25,26) |
| InChIKey | CUXQTDKDYJOEJA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|