C19H27F3N4O2 — CID 111189544
N-[2-[[ethylamino-[(4-hydroxycyclohexyl)amino]methylidene]amino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 111189544) has the molecular formula C19H27F3N4O2 and a molecular weight of 400.45 g/mol. Its IUPAC name is N-[2-[[ethylamino-[(4-hydroxycyclohexyl)amino]methylidene]amino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[ethylamino-[(4-hydroxycyclohexyl)amino]methylidene]amino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 111189544 |
| Molecular Formula | C19H27F3N4O2 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | N-[2-[[ethylamino-[(4-hydroxycyclohexyl)amino]methylidene]amino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccc(C(F)(F)F)cc1)NC1CCC(O)CC1 |
| InChI | InChI=1S/C19H27F3N4O2/c1-2-23-18(26-15-7-9-16(27)10-8-15)25-12-11-24-17(28)13-3-5-14(6-4-13)19(20,21)22/h3-6,15-16,27H,2,7-12H2,1H3,(H,24,28)(H2,23,25,26) |
| InChIKey | JIWDMMYZIBNOBP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|