C18H27ClN4O2 — CID 111189216
4-chloro-N-[2-[[ethylamino-[(4-hydroxycyclohexyl)amino]methylidene]amino]ethyl]benzamide (PubChem CID 111189216) has the molecular formula C18H27ClN4O2 and a molecular weight of 366.89 g/mol. Its IUPAC name is 4-chloro-N-[2-[[ethylamino-[(4-hydroxycyclohexyl)amino]methylidene]amino]ethyl]benzamide.
| Compound Name | 4-chloro-N-[2-[[ethylamino-[(4-hydroxycyclohexyl)amino]methylidene]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111189216 |
| Molecular Formula | C18H27ClN4O2 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 4-chloro-N-[2-[[ethylamino-[(4-hydroxycyclohexyl)amino]methylidene]amino]ethyl]benzamide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccc(Cl)cc1)NC1CCC(O)CC1 |
| InChI | InChI=1S/C18H27ClN4O2/c1-2-20-18(23-15-7-9-16(24)10-8-15)22-12-11-21-17(25)13-3-5-14(19)6-4-13/h3-6,15-16,24H,2,7-12H2,1H3,(H,21,25)(H2,20,22,23) |
| InChIKey | CUTMRTAUAGDLLD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|