C19H30IN3O3 — CID 111190193
methyl 4-[2-[[ethylamino-[(4-hydroxycyclohexyl)amino]methylidene]amino]ethyl]benzoate;hydroiodide (PubChem CID 111190193) has the molecular formula C19H30IN3O3 and a molecular weight of 475.37 g/mol. Its IUPAC name is methyl 4-[2-[[ethylamino-[(4-hydroxycyclohexyl)amino]methylidene]amino]ethyl]benzoate;hydroiodide.
| Compound Name | methyl 4-[2-[[ethylamino-[(4-hydroxycyclohexyl)amino]methylidene]amino]ethyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111190193 |
| Molecular Formula | C19H30IN3O3 |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | methyl 4-[2-[[ethylamino-[(4-hydroxycyclohexyl)amino]methylidene]amino]ethyl]benzoate;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(C(=O)OC)cc1)NC1CCC(O)CC1.I |
| InChI | InChI=1S/C19H29N3O3.HI/c1-3-20-19(22-16-8-10-17(23)11-9-16)21-13-12-14-4-6-15(7-5-14)18(24)25-2;/h4-7,16-17,23H,3,8-13H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | MFZVLVVSAIHYNQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|