C16H23FN4O — CID 110988552
N-[2-[[(cyclopropylamino)-(ethylamino)methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide (PubChem CID 110988552) has the molecular formula C16H23FN4O and a molecular weight of 306.38 g/mol. Its IUPAC name is N-[2-[[(cyclopropylamino)-(ethylamino)methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[2-[[(cyclopropylamino)-(ethylamino)methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 110988552 |
| Molecular Formula | C16H23FN4O |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-[2-[[(cyclopropylamino)-(ethylamino)methylidene]amino]ethyl]-2-(4-fluorophenyl)acetamide |
| SMILES | CCN/C(=N\CCNC(=O)Cc1ccc(F)cc1)NC1CC1 |
| InChI | InChI=1S/C16H23FN4O/c1-2-18-16(21-14-7-8-14)20-10-9-19-15(22)11-12-3-5-13(17)6-4-12/h3-6,14H,2,7-11H2,1H3,(H,19,22)(H2,18,20,21) |
| InChIKey | NDKLGUHNLICEEC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|