C18H26F3N3O2S — CID 111835115
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine (PubChem CID 111835115) has the molecular formula C18H26F3N3O2S and a molecular weight of 405.49 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine |
|---|---|
| PubChem CID | 111835115 |
| Molecular Formula | C18H26F3N3O2S |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[3-[3-(trifluoromethyl)phenyl]butyl]guanidine |
| SMILES | CCN/C(=N\CCC(C)c1cccc(C(F)(F)F)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H26F3N3O2S/c1-3-22-17(24-16-8-10-27(25,26)12-16)23-9-7-13(2)14-5-4-6-15(11-14)18(19,20)21/h4-6,11,13,16H,3,7-10,12H2,1-2H3,(H2,22,23,24) |
| InChIKey | PDEYXTSUWNFSDT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|