C18H31IN4O2S — CID 111141624
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(N-ethyl-3-methylanilino)ethyl]guanidine;hydroiodide (PubChem CID 111141624) has the molecular formula C18H31IN4O2S and a molecular weight of 494.44 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(N-ethyl-3-methylanilino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(N-ethyl-3-methylanilino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111141624 |
| Molecular Formula | C18H31IN4O2S |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(N-ethyl-3-methylanilino)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN(CC)c1cccc(C)c1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C18H30N4O2S.HI/c1-4-19-18(21-16-9-12-25(23,24)14-16)20-10-11-22(5-2)17-8-6-7-15(3)13-17;/h6-8,13,16H,4-5,9-12,14H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | YFCVWILOVHBZFQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|