C17H27ClIN3O2S — CID 111143237
2-[2-(3-chlorophenyl)-2-methylpropyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide (PubChem CID 111143237) has the molecular formula C17H27ClIN3O2S and a molecular weight of 499.85 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)-2-methylpropyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[2-(3-chlorophenyl)-2-methylpropyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111143237 |
| Molecular Formula | C17H27ClIN3O2S |
| Molecular Weight | 499.85 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | 2-[2-(3-chlorophenyl)-2-methylpropyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)c1cccc(Cl)c1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C17H26ClN3O2S.HI/c1-4-19-16(21-15-8-9-24(22,23)11-15)20-12-17(2,3)13-6-5-7-14(18)10-13;/h5-7,10,15H,4,8-9,11-12H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | XQGWOLDTJABQBG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.85 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|