C20H34IN3O2S — CID 111792287
2-(2,2-dimethyl-5-phenylpentyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide (PubChem CID 111792287) has the molecular formula C20H34IN3O2S and a molecular weight of 507.48 g/mol. Its IUPAC name is 2-(2,2-dimethyl-5-phenylpentyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide.
| Compound Name | 2-(2,2-dimethyl-5-phenylpentyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111792287 |
| Molecular Formula | C20H34IN3O2S |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | 2-(2,2-dimethyl-5-phenylpentyl)-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)CCCc1ccccc1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C20H33N3O2S.HI/c1-4-21-19(23-18-12-14-26(24,25)15-18)22-16-20(2,3)13-8-11-17-9-6-5-7-10-17;/h5-7,9-10,18H,4,8,11-16H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | ZDJDWZHXNLJVJF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|