C17H27FIN3O2S — CID 111143651
1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(2-fluorophenyl)-2-methylpropyl]guanidine;hydroiodide (PubChem CID 111143651) has the molecular formula C17H27FIN3O2S and a molecular weight of 483.39 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(2-fluorophenyl)-2-methylpropyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(2-fluorophenyl)-2-methylpropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111143651 |
| Molecular Formula | C17H27FIN3O2S |
| Molecular Weight | 483.39 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethyl-2-[2-(2-fluorophenyl)-2-methylpropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)c1ccccc1F)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C17H26FN3O2S.HI/c1-4-19-16(21-13-9-10-24(22,23)11-13)20-12-17(2,3)14-7-5-6-8-15(14)18;/h5-8,13H,4,9-12H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | XKAFKAIRPMPBNS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|