C16H26FN3 — CID 111227779
1-ethyl-2-[2-(2-fluorophenyl)-2-methylpropyl]-3-propylguanidine (PubChem CID 111227779) has the molecular formula C16H26FN3 and a molecular weight of 279.40 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-fluorophenyl)-2-methylpropyl]-3-propylguanidine.
| Compound Name | 1-ethyl-2-[2-(2-fluorophenyl)-2-methylpropyl]-3-propylguanidine |
|---|---|
| PubChem CID | 111227779 |
| Molecular Formula | C16H26FN3 |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 1-ethyl-2-[2-(2-fluorophenyl)-2-methylpropyl]-3-propylguanidine |
| SMILES | CCCN/C(=N/CC(C)(C)c1ccccc1F)NCC |
| InChI | InChI=1S/C16H26FN3/c1-5-11-19-15(18-6-2)20-12-16(3,4)13-9-7-8-10-14(13)17/h7-10H,5-6,11-12H2,1-4H3,(H2,18,19,20) |
| InChIKey | SOSMBZGZKZDNQV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|