C16H26FN3O2S — CID 111967659
1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-(2-methyl-2-methylsulfonylpropyl)guanidine (PubChem CID 111967659) has the molecular formula C16H26FN3O2S and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-(2-methyl-2-methylsulfonylpropyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-(2-methyl-2-methylsulfonylpropyl)guanidine |
|---|---|
| PubChem CID | 111967659 |
| Molecular Formula | C16H26FN3O2S |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-(2-methyl-2-methylsulfonylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)S(C)(=O)=O)NCCc1ccccc1F |
| InChI | InChI=1S/C16H26FN3O2S/c1-5-18-15(20-12-16(2,3)23(4,21)22)19-11-10-13-8-6-7-9-14(13)17/h6-9H,5,10-12H2,1-4H3,(H2,18,19,20) |
| InChIKey | ALQVRMNTPPNWAD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|